C20H25NO5S — CID 6976853
ethyl (3S)-3-(2-aminophenyl)sulfanyl-3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 6976853) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is ethyl (3S)-3-(2-aminophenyl)sulfanyl-3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | ethyl (3S)-3-(2-aminophenyl)sulfanyl-3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 6976853 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | ethyl (3S)-3-(2-aminophenyl)sulfanyl-3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](Sc1ccccc1N)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-5-26-19(22)12-18(27-17-9-7-6-8-14(17)21)13-10-15(23-2)20(25-4)16(11-13)24-3/h6-11,18H,5,12,21H2,1-4H3/t18-/m0/s1 |
| InChIKey | WUYBYEYBTLBQPZ-SFHVURJKSA-N |
| XLogP | 4.08 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|