C23H23BrN2OS — CID 56696437
3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]propan-1-one (PubChem CID 56696437) has the molecular formula C23H23BrN2OS and a molecular weight of 455.42 g/mol. Its IUPAC name is 3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]propan-1-one.
| Compound Name | 3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]propan-1-one |
|---|---|
| PubChem CID | 56696437 |
| Molecular Formula | C23H23BrN2OS |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]propan-1-one |
| SMILES | CN(C)c1ccc(C(CC(=O)c2ccc(Br)cc2)Sc2ccccc2N)cc1 |
| InChI | InChI=1S/C23H23BrN2OS/c1-26(2)19-13-9-17(10-14-19)23(28-22-6-4-3-5-20(22)25)15-21(27)16-7-11-18(24)12-8-16/h3-14,23H,15,25H2,1-2H3 |
| InChIKey | VVTDGIMUWGTGTI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|