C22H16F2O3S — CID 7214500
2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]sulfanylbenzoic acid (PubChem CID 7214500) has the molecular formula C22H16F2O3S and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]sulfanylbenzoic acid.
| Compound Name | 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 7214500 |
| Molecular Formula | C22H16F2O3S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]sulfanylbenzoic acid |
| SMILES | O=C(C[C@@H](Sc1ccccc1C(=O)O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16F2O3S/c23-16-9-5-14(6-10-16)19(25)13-21(15-7-11-17(24)12-8-15)28-20-4-2-1-3-18(20)22(26)27/h1-12,21H,13H2,(H,26,27)/t21-/m1/s1 |
| InChIKey | VNNKXHKPVNCETH-OAQYLSRUSA-N |
| XLogP | 5.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |