C17H20N2O3S — CID 57223133
(2S,3S)-3-(2-aminophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)-N-methylpropanamide (PubChem CID 57223133) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is (2S,3S)-3-(2-aminophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)-N-methylpropanamide.
| Compound Name | (2S,3S)-3-(2-aminophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 57223133 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2S,3S)-3-(2-aminophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](O)[C@@H](Sc1ccccc1N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-19-17(21)15(20)16(11-7-9-12(22-2)10-8-11)23-14-6-4-3-5-13(14)18/h3-10,15-16,20H,18H2,1-2H3,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | MWCDNSBYWIYWHU-CVEARBPZSA-N |
| XLogP | 2.22 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|