C22H21NO5S — CID 10093047
(2S,3S)-3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid (PubChem CID 10093047) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is (2S,3S)-3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | (2S,3S)-3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 10093047 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2S,3S)-3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@H](Sc2cc(Oc3ccccc3)ccc2N)[C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-27-15-9-7-14(8-10-15)21(20(24)22(25)26)29-19-13-17(11-12-18(19)23)28-16-5-3-2-4-6-16/h2-13,20-21,24H,23H2,1H3,(H,25,26)/t20-,21+/m1/s1 |
| InChIKey | KOHHAYZOZFKLSR-RTWAWAEBSA-N |
| XLogP | 4.35 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|