C17H19NO5S — CID 10473007
(2S,3S)-3-(2-amino-5-methoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid (PubChem CID 10473007) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is (2S,3S)-3-(2-amino-5-methoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | (2S,3S)-3-(2-amino-5-methoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 10473007 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2S,3S)-3-(2-amino-5-methoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@H](Sc2cc(OC)ccc2N)[C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-22-11-5-3-10(4-6-11)16(15(19)17(20)21)24-14-9-12(23-2)7-8-13(14)18/h3-9,15-16,19H,18H2,1-2H3,(H,20,21)/t15-,16+/m1/s1 |
| InChIKey | RROVHCWZFGVBRY-CVEARBPZSA-N |
| XLogP | 2.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|