C22H28ClN3O8S — CID 15593460
3-(5-chloro-2-nitrophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 15593460) has the molecular formula C22H28ClN3O8S and a molecular weight of 530.00 g/mol. Its IUPAC name is 3-(5-chloro-2-nitrophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | 3-(5-chloro-2-nitrophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 15593460 |
| Molecular Formula | C22H28ClN3O8S |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-(5-chloro-2-nitrophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | COc1ccc(C(Sc2cc(Cl)ccc2[N+](=O)[O-])C(O)C(=O)O)cc1.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H14ClNO6S.C6H14N2O2/c1-24-11-5-2-9(3-6-11)15(14(19)16(20)21)25-13-8-10(17)4-7-12(13)18(22)23;7-4-2-1-3-5(8)6(9)10/h2-8,14-15,19H,1H3,(H,20,21);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | QYVZXXKOBDNCPY-ZSCHJXSPSA-N |
| XLogP | 3.06 |
| TPSA | 199.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|