C15H15ClN2O4 — CID 119040025
2-(5-chloro-2-nitroanilino)-1-(4-methoxyphenyl)ethanol (PubChem CID 119040025) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is 2-(5-chloro-2-nitroanilino)-1-(4-methoxyphenyl)ethanol.
| Compound Name | 2-(5-chloro-2-nitroanilino)-1-(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 119040025 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-(5-chloro-2-nitroanilino)-1-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)CNc2cc(Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15ClN2O4/c1-22-12-5-2-10(3-6-12)15(19)9-17-13-8-11(16)4-7-14(13)18(20)21/h2-8,15,17,19H,9H2,1H3 |
| InChIKey | XXUAYAOTOHOPMS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|