C11H15ClN2O4 — CID 114100735
5-chloro-N-(2,3-dimethoxypropyl)-2-nitroaniline (PubChem CID 114100735) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dimethoxypropyl)-2-nitroaniline.
| Compound Name | 5-chloro-N-(2,3-dimethoxypropyl)-2-nitroaniline |
|---|---|
| PubChem CID | 114100735 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-chloro-N-(2,3-dimethoxypropyl)-2-nitroaniline |
| SMILES | COCC(CNc1cc(Cl)ccc1[N+](=O)[O-])OC |
| InChI | InChI=1S/C11H15ClN2O4/c1-17-7-9(18-2)6-13-10-5-8(12)3-4-11(10)14(15)16/h3-5,9,13H,6-7H2,1-2H3 |
| InChIKey | DJCPUDUJGHEUHZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|