C18H19NO5S — CID 148638396
methyl (2S,3R)-3-(4-methoxyphenyl)-2-methyl-3-(2-nitrophenyl)sulfanylpropanoate (PubChem CID 148638396) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl (2S,3R)-3-(4-methoxyphenyl)-2-methyl-3-(2-nitrophenyl)sulfanylpropanoate.
| Compound Name | methyl (2S,3R)-3-(4-methoxyphenyl)-2-methyl-3-(2-nitrophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 148638396 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl (2S,3R)-3-(4-methoxyphenyl)-2-methyl-3-(2-nitrophenyl)sulfanylpropanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](Sc1ccccc1[N+](=O)[O-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO5S/c1-12(18(20)24-3)17(13-8-10-14(23-2)11-9-13)25-16-7-5-4-6-15(16)19(21)22/h4-12,17H,1-3H3/t12-,17-/m1/s1 |
| InChIKey | NJNJDJGLPLNWET-SJKOYZFVSA-N |
| XLogP | 4.25 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|