C20H21NO8S — CID 13468966
methyl (2S,3S)-3-(4-acetyloxyphenyl)-2-(methoxymethoxy)-3-(2-nitrophenyl)sulfanylpropanoate (PubChem CID 13468966) has the molecular formula C20H21NO8S and a molecular weight of 435.45 g/mol. Its IUPAC name is methyl (2S,3S)-3-(4-acetyloxyphenyl)-2-(methoxymethoxy)-3-(2-nitrophenyl)sulfanylpropanoate.
| Compound Name | methyl (2S,3S)-3-(4-acetyloxyphenyl)-2-(methoxymethoxy)-3-(2-nitrophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 13468966 |
| Molecular Formula | C20H21NO8S |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | methyl (2S,3S)-3-(4-acetyloxyphenyl)-2-(methoxymethoxy)-3-(2-nitrophenyl)sulfanylpropanoate |
| SMILES | COCO[C@@H](C(=O)OC)[C@@H](Sc1ccccc1[N+](=O)[O-])c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C20H21NO8S/c1-13(22)29-15-10-8-14(9-11-15)19(18(20(23)27-3)28-12-26-2)30-17-7-5-4-6-16(17)21(24)25/h4-11,18-19H,12H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | ZVFSUZDEVVRLCM-MOPGFXCFSA-N |
| XLogP | 3.52 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|