C27H24F3NO8S — CID 10817041
[(2S,3S)-1-methoxy-3-(4-methoxyphenyl)-3-(2-nitrophenyl)sulfanyl-1-oxopropan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10817041) has the molecular formula C27H24F3NO8S and a molecular weight of 579.55 g/mol. Its IUPAC name is [(2S,3S)-1-methoxy-3-(4-methoxyphenyl)-3-(2-nitrophenyl)sulfanyl-1-oxopropan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,3S)-1-methoxy-3-(4-methoxyphenyl)-3-(2-nitrophenyl)sulfanyl-1-oxopropan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10817041 |
| Molecular Formula | C27H24F3NO8S |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | [(2S,3S)-1-methoxy-3-(4-methoxyphenyl)-3-(2-nitrophenyl)sulfanyl-1-oxopropan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(=O)[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@@H](Sc1ccccc1[N+](=O)[O-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H24F3NO8S/c1-36-19-15-13-17(14-16-19)23(40-21-12-8-7-11-20(21)31(34)35)22(24(32)37-2)39-25(33)26(38-3,27(28,29)30)18-9-5-4-6-10-18/h4-16,22-23H,1-3H3/t22-,23+,26-/m1/s1 |
| InChIKey | INUNQMFJEBBNSA-MVERNJQCSA-N |
| XLogP | 5.63 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|