C25H23F3O4 — CID 53474412
[(3S)-7-(4-methoxyphenyl)-2-methylhepta-4,6-diyn-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 53474412) has the molecular formula C25H23F3O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is [(3S)-7-(4-methoxyphenyl)-2-methylhepta-4,6-diyn-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3S)-7-(4-methoxyphenyl)-2-methylhepta-4,6-diyn-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 53474412 |
| Molecular Formula | C25H23F3O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(3S)-7-(4-methoxyphenyl)-2-methylhepta-4,6-diyn-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COc1ccc(C#CC#C[C@@H](OC(=O)[C@](OC)(c2ccccc2)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C25H23F3O4/c1-18(2)22(13-9-8-10-19-14-16-21(30-3)17-15-19)32-23(29)24(31-4,25(26,27)28)20-11-6-5-7-12-20/h5-7,11-12,14-18,22H,1-4H3/t22-,24-/m1/s1 |
| InChIKey | PQLNFIHNXLVGRA-ISKFKSNPSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|