C24H29F3O4S — CID 10766744
[(2S,3S,4R)-1-hydroxy-2,5-dimethyl-4-phenylsulfanylhexan-3-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10766744) has the molecular formula C24H29F3O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is [(2S,3S,4R)-1-hydroxy-2,5-dimethyl-4-phenylsulfanylhexan-3-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,3S,4R)-1-hydroxy-2,5-dimethyl-4-phenylsulfanylhexan-3-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10766744 |
| Molecular Formula | C24H29F3O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [(2S,3S,4R)-1-hydroxy-2,5-dimethyl-4-phenylsulfanylhexan-3-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)O[C@H]([C@H](Sc1ccccc1)C(C)C)[C@@H](C)CO)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H29F3O4S/c1-16(2)21(32-19-13-9-6-10-14-19)20(17(3)15-28)31-22(29)23(30-4,24(25,26)27)18-11-7-5-8-12-18/h5-14,16-17,20-21,28H,15H2,1-4H3/t17-,20-,21+,23?/m0/s1 |
| InChIKey | UTJYSRXAHMKECO-BTEHJBJGSA-N |
| XLogP | 5.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |