C27H41F3O5 — CID 11375520
methyl (2R,3R)-2,4,6,8,10-pentamethyl-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyundecanoate (PubChem CID 11375520) has the molecular formula C27H41F3O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is methyl (2R,3R)-2,4,6,8,10-pentamethyl-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyundecanoate.
| Compound Name | methyl (2R,3R)-2,4,6,8,10-pentamethyl-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyundecanoate |
|---|---|
| PubChem CID | 11375520 |
| Molecular Formula | C27H41F3O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | methyl (2R,3R)-2,4,6,8,10-pentamethyl-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyundecanoate |
| SMILES | COC(=O)[C@H](C)[C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)C(C)CC(C)CC(C)CC(C)C |
| InChI | InChI=1S/C27H41F3O5/c1-17(2)14-18(3)15-19(4)16-20(5)23(21(6)24(31)33-7)35-25(32)26(34-8,27(28,29)30)22-12-10-9-11-13-22/h9-13,17-21,23H,14-16H2,1-8H3/t18?,19?,20?,21-,23-,26+/m1/s1 |
| InChIKey | BUPIAXPLLYIXQP-YGTHYSFOSA-N |
| XLogP | 6.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |