C18H16BrF3O3 — CID 71507179
[(2S)-2-bromo-2-deuterio-1-phenylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 71507179) has the molecular formula C18H16BrF3O3 and a molecular weight of 418.23 g/mol. Its IUPAC name is [(2S)-2-bromo-2-deuterio-1-phenylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S)-2-bromo-2-deuterio-1-phenylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 71507179 |
| Molecular Formula | C18H16BrF3O3 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | [(2S)-2-bromo-2-deuterio-1-phenylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | [2H][C@H](Br)C(OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H16BrF3O3/c1-24-17(18(20,21)22,14-10-6-3-7-11-14)16(23)25-15(12-19)13-8-4-2-5-9-13/h2-11,15H,12H2,1H3/t15?,17-/m0/s1/i12D/t12-,15?,17- |
| InChIKey | JTBCIBCJYMXHBS-GKIJXWBHSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|