C18H18N2O6S — CID 8946053
[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)sulfanylacetate (PubChem CID 8946053) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)sulfanylacetate.
| Compound Name | [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8946053 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)sulfanylacetate |
| SMILES | COc1ccc(NC(=O)[C@@H](C)OC(=O)CSc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-12(18(22)19-13-7-9-14(25-2)10-8-13)26-17(21)11-27-16-6-4-3-5-15(16)20(23)24/h3-10,12H,11H2,1-2H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | GUOBBCSHBPNABB-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|