C19H17N3O7S — CID 55422209
[1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-benzoxazol-2-ylsulfanyl)acetate (PubChem CID 55422209) has the molecular formula C19H17N3O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-benzoxazol-2-ylsulfanyl)acetate.
| Compound Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 55422209 |
| Molecular Formula | C19H17N3O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)CSc2nc3ccccc3o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N3O7S/c1-11(18(24)20-13-8-7-12(27-2)9-15(13)22(25)26)28-17(23)10-30-19-21-14-5-3-4-6-16(14)29-19/h3-9,11H,10H2,1-2H3,(H,20,24) |
| InChIKey | QAGYFAWOCKIYSI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|