C16H16FNO4S — CID 70408870
3-(2-amino-6-fluorophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid (PubChem CID 70408870) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is 3-(2-amino-6-fluorophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-(2-amino-6-fluorophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 70408870 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-(2-amino-6-fluorophenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(Sc2c(N)cccc2F)C(O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H16FNO4S/c1-22-10-7-5-9(6-8-10)14(13(19)16(20)21)23-15-11(17)3-2-4-12(15)18/h2-8,13-14,19H,18H2,1H3,(H,20,21) |
| InChIKey | MKCUAKDCXLOASU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|