C11H11Cl3O2 — CID 2775711
4,4,4-trichloro-3-hydroxy-1-(4-methylphenyl)butan-1-one (PubChem CID 2775711) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is 4,4,4-trichloro-3-hydroxy-1-(4-methylphenyl)butan-1-one.
| Compound Name | 4,4,4-trichloro-3-hydroxy-1-(4-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 2775711 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 4,4,4-trichloro-3-hydroxy-1-(4-methylphenyl)butan-1-one |
| SMILES | Cc1ccc(C(=O)CC(O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H11Cl3O2/c1-7-2-4-8(5-3-7)9(15)6-10(16)11(12,13)14/h2-5,10,16H,6H2,1H3 |
| InChIKey | ALHKSNFTWYSNTD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|