C20H20O4 — CID 154173226
3-(4-methylbenzoyl)-5-(4-methylphenyl)-5-oxopentanoic acid (PubChem CID 154173226) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(4-methylbenzoyl)-5-(4-methylphenyl)-5-oxopentanoic acid.
| Compound Name | 3-(4-methylbenzoyl)-5-(4-methylphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 154173226 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-(4-methylbenzoyl)-5-(4-methylphenyl)-5-oxopentanoic acid |
| SMILES | Cc1ccc(C(=O)CC(CC(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H20O4/c1-13-3-7-15(8-4-13)18(21)11-17(12-19(22)23)20(24)16-9-5-14(2)6-10-16/h3-10,17H,11-12H2,1-2H3,(H,22,23) |
| InChIKey | HMPPCWBUZVWLHB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |