C24H20Cl2O2 — CID 66572947
1,3-bis(4-chlorophenyl)-5-(4-methylphenyl)pentane-1,5-dione (PubChem CID 66572947) has the molecular formula C24H20Cl2O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)-5-(4-methylphenyl)pentane-1,5-dione.
| Compound Name | 1,3-bis(4-chlorophenyl)-5-(4-methylphenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 66572947 |
| Molecular Formula | C24H20Cl2O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)-5-(4-methylphenyl)pentane-1,5-dione |
| SMILES | Cc1ccc(C(=O)CC(CC(=O)c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20Cl2O2/c1-16-2-4-18(5-3-16)23(27)14-20(17-6-10-21(25)11-7-17)15-24(28)19-8-12-22(26)13-9-19/h2-13,20H,14-15H2,1H3 |
| InChIKey | IJVSJYFIUGSPJR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |