C18H17ClO2 — CID 46242276
(3S)-1-(4-chlorophenyl)-3-phenylhexane-1,5-dione (PubChem CID 46242276) has the molecular formula C18H17ClO2 and a molecular weight of 300.79 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-phenylhexane-1,5-dione.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-phenylhexane-1,5-dione |
|---|---|
| PubChem CID | 46242276 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-phenylhexane-1,5-dione |
| SMILES | CC(=O)C[C@@H](CC(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H17ClO2/c1-13(20)11-16(14-5-3-2-4-6-14)12-18(21)15-7-9-17(19)10-8-15/h2-10,16H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | PFRHESYQXQJPTP-INIZCTEOSA-N |
| XLogP | 4.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |