C24H21ClO3 — CID 57258892
1-(4-chlorophenyl)-5-(4-methoxyphenyl)-3-phenylpentane-1,5-dione (PubChem CID 57258892) has the molecular formula C24H21ClO3 and a molecular weight of 392.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-3-phenylpentane-1,5-dione.
| Compound Name | 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-3-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 57258892 |
| Molecular Formula | C24H21ClO3 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-3-phenylpentane-1,5-dione |
| SMILES | COc1ccc(C(=O)CC(CC(=O)c2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21ClO3/c1-28-22-13-9-19(10-14-22)24(27)16-20(17-5-3-2-4-6-17)15-23(26)18-7-11-21(25)12-8-18/h2-14,20H,15-16H2,1H3 |
| InChIKey | PKHCGCQFESZEJF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |