C33H25Cl2NO3 — CID 132563705
1,5-bis(4-chlorophenyl)-3-[2-(4-methoxyphenyl)quinolin-3-yl]pentane-1,5-dione (PubChem CID 132563705) has the molecular formula C33H25Cl2NO3 and a molecular weight of 554.47 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)-3-[2-(4-methoxyphenyl)quinolin-3-yl]pentane-1,5-dione.
| Compound Name | 1,5-bis(4-chlorophenyl)-3-[2-(4-methoxyphenyl)quinolin-3-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 132563705 |
| Molecular Formula | C33H25Cl2NO3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 1,5-bis(4-chlorophenyl)-3-[2-(4-methoxyphenyl)quinolin-3-yl]pentane-1,5-dione |
| SMILES | COc1ccc(-c2nc3ccccc3cc2C(CC(=O)c2ccc(Cl)cc2)CC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H25Cl2NO3/c1-39-28-16-10-23(11-17-28)33-29(18-24-4-2-3-5-30(24)36-33)25(19-31(37)21-6-12-26(34)13-7-21)20-32(38)22-8-14-27(35)15-9-22/h2-18,25H,19-20H2,1H3 |
| InChIKey | CWXIKGSIGJCXPG-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |