C40H33NO4 — CID 132563711
1,5-bis(4-methoxyphenyl)-3-[2-(2-phenylphenyl)quinolin-3-yl]pentane-1,5-dione (PubChem CID 132563711) has the molecular formula C40H33NO4 and a molecular weight of 591.71 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-3-[2-(2-phenylphenyl)quinolin-3-yl]pentane-1,5-dione.
| Compound Name | 1,5-bis(4-methoxyphenyl)-3-[2-(2-phenylphenyl)quinolin-3-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 132563711 |
| Molecular Formula | C40H33NO4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-3-[2-(2-phenylphenyl)quinolin-3-yl]pentane-1,5-dione |
| SMILES | COc1ccc(C(=O)CC(CC(=O)c2ccc(OC)cc2)c2cc3ccccc3nc2-c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H33NO4/c1-44-32-20-16-28(17-21-32)38(42)25-31(26-39(43)29-18-22-33(45-2)23-19-29)36-24-30-12-6-9-15-37(30)41-40(36)35-14-8-7-13-34(35)27-10-4-3-5-11-27/h3-24,31H,25-26H2,1-2H3 |
| InChIKey | VBCLFVCDRCPRKX-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |