5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid

C24H22O4 — CID 11111556

IUPAC5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid
SMILESCOc1ccc(C(=O)CC(c2ccccc2)C(C(=O)O)c2ccccc2)cc1
InChIInChI=1S/C24H22O4/c1-28-20-14-12-18(13-15-20)22(25)16-21(17-8-4-2-5-9-17)23(24(26)27)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3,(H,26,27)
InChIKeyQSTNFAHLTANHAC-UHFFFAOYSA-N
MW374.44 g/mol
LogP4.92
Rot. Bonds8

About 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid

5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid (PubChem CID 11111556) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid.

Molecular Properties

Compound Name5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid
PubChem CID11111556
Molecular FormulaC24H22O4
Molecular Weight374.44 g/mol
Exact Mass374.15
IUPAC Name5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid
SMILESCOc1ccc(C(=O)CC(c2ccccc2)C(C(=O)O)c2ccccc2)cc1
InChIInChI=1S/C24H22O4/c1-28-20-14-12-18(13-15-20)22(25)16-21(17-8-4-2-5-9-17)23(24(26)27)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3,(H,26,27)
InChIKeyQSTNFAHLTANHAC-UHFFFAOYSA-N
XLogP4.92
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500374.44
LogP ≤ 54.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid?
The IUPAC name of 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid (CID 11111556) is 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid.
What is the SMILES notation for 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid?
The canonical SMILES for 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid is COc1ccc(C(=O)CC(c2ccccc2)C(C(=O)O)c2ccccc2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid?
The InChIKey is QSTNFAHLTANHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4/c1-28-20-14-12-18(13-15-20)22(25)16-21(17-8-4-2-5-9-17)23(24(26)27)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3,(H,26,27).
What are the key properties of 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid?
5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid has a molecular weight of 374.44 g/mol, XLogP of 4.92, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid is sourced from PubChem (CID 11111556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).