C30H24O4 — CID 122221336
2-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylbutane-1,4-dione (PubChem CID 122221336) has the molecular formula C30H24O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylbutane-1,4-dione.
| Compound Name | 2-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 122221336 |
| Molecular Formula | C30H24O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylbutane-1,4-dione |
| SMILES | COc1ccc(C(=O)C(C(=O)c2ccccc2)C(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24O4/c1-34-25-19-17-24(18-20-25)30(33)27(29(32)23-15-9-4-10-16-23)26(21-11-5-2-6-12-21)28(31)22-13-7-3-8-14-22/h2-20,26-27H,1H3 |
| InChIKey | NWRKDKMSGOXGMJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|