C20H20O3 — CID 122378401
(2S)-1-(4-methoxyphenyl)-2-[(1S)-1-phenylprop-2-enyl]butane-1,3-dione (PubChem CID 122378401) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S)-1-(4-methoxyphenyl)-2-[(1S)-1-phenylprop-2-enyl]butane-1,3-dione.
| Compound Name | (2S)-1-(4-methoxyphenyl)-2-[(1S)-1-phenylprop-2-enyl]butane-1,3-dione |
|---|---|
| PubChem CID | 122378401 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2S)-1-(4-methoxyphenyl)-2-[(1S)-1-phenylprop-2-enyl]butane-1,3-dione |
| SMILES | C=C[C@H](c1ccccc1)[C@@H](C(C)=O)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H20O3/c1-4-18(15-8-6-5-7-9-15)19(14(2)21)20(22)16-10-12-17(23-3)13-11-16/h4-13,18-19H,1H2,2-3H3/t18-,19-/m1/s1 |
| InChIKey | CNJRRFQBIBVMCW-RTBURBONSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|