C22H22O4 — CID 71712413
methyl (3R,4S)-4-(4-methoxybenzoyl)-2-methylidene-3-phenylhex-5-enoate (PubChem CID 71712413) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is methyl (3R,4S)-4-(4-methoxybenzoyl)-2-methylidene-3-phenylhex-5-enoate.
| Compound Name | methyl (3R,4S)-4-(4-methoxybenzoyl)-2-methylidene-3-phenylhex-5-enoate |
|---|---|
| PubChem CID | 71712413 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | methyl (3R,4S)-4-(4-methoxybenzoyl)-2-methylidene-3-phenylhex-5-enoate |
| SMILES | C=C[C@H](C(=O)c1ccc(OC)cc1)[C@@H](C(=C)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C22H22O4/c1-5-19(21(23)17-11-13-18(25-3)14-12-17)20(15(2)22(24)26-4)16-9-7-6-8-10-16/h5-14,19-20H,1-2H2,3-4H3/t19-,20-/m0/s1 |
| InChIKey | DHQIXDKGSPRREQ-PMACEKPBSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|