C21H20O3 — CID 71714346
methyl (3R,4S)-4-benzoyl-2-methylidene-3-phenylhex-5-enoate (PubChem CID 71714346) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (3R,4S)-4-benzoyl-2-methylidene-3-phenylhex-5-enoate.
| Compound Name | methyl (3R,4S)-4-benzoyl-2-methylidene-3-phenylhex-5-enoate |
|---|---|
| PubChem CID | 71714346 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl (3R,4S)-4-benzoyl-2-methylidene-3-phenylhex-5-enoate |
| SMILES | C=C[C@H](C(=O)c1ccccc1)[C@@H](C(=C)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C21H20O3/c1-4-18(20(22)17-13-9-6-10-14-17)19(15(2)21(23)24-3)16-11-7-5-8-12-16/h4-14,18-19H,1-2H2,3H3/t18-,19-/m0/s1 |
| InChIKey | XDYDIHGFMARMDR-OALUTQOASA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|