C19H17NO3 — CID 58957333
methyl (3S,4R)-4-hydroxy-4-(4-isocyanophenyl)-2-methylidene-3-phenylbutanoate (PubChem CID 58957333) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl (3S,4R)-4-hydroxy-4-(4-isocyanophenyl)-2-methylidene-3-phenylbutanoate.
| Compound Name | methyl (3S,4R)-4-hydroxy-4-(4-isocyanophenyl)-2-methylidene-3-phenylbutanoate |
|---|---|
| PubChem CID | 58957333 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl (3S,4R)-4-hydroxy-4-(4-isocyanophenyl)-2-methylidene-3-phenylbutanoate |
| SMILES | [C-]#[N+]c1ccc([C@H](O)[C@H](C(=C)C(=O)OC)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-13(19(22)23-3)17(14-7-5-4-6-8-14)18(21)15-9-11-16(20-2)12-10-15/h4-12,17-18,21H,1H2,3H3/t17-,18+/m1/s1 |
| InChIKey | SWKOMJRSFKWUCK-MSOLQXFVSA-N |
| XLogP | 3.78 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|