C26H24O5 — CID 101477479
4,5-bis(4-methoxyphenyl)-2-methylidene-5-oxo-3-phenylpentanoic acid (PubChem CID 101477479) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-methylidene-5-oxo-3-phenylpentanoic acid.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-methylidene-5-oxo-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 101477479 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-methylidene-5-oxo-3-phenylpentanoic acid |
| SMILES | C=C(C(=O)O)C(c1ccccc1)C(C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H24O5/c1-17(26(28)29)23(18-7-5-4-6-8-18)24(19-9-13-21(30-2)14-10-19)25(27)20-11-15-22(31-3)16-12-20/h4-16,23-24H,1H2,2-3H3,(H,28,29) |
| InChIKey | QKNPLHKGKAKWAP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|