C33H28O6 — CID 98126561
2-[(1S,2S)-1,2,3-tris(4-methoxyphenyl)-3-oxopropyl]indene-1,3-dione (PubChem CID 98126561) has the molecular formula C33H28O6 and a molecular weight of 520.58 g/mol. Its IUPAC name is 2-[(1S,2S)-1,2,3-tris(4-methoxyphenyl)-3-oxopropyl]indene-1,3-dione.
| Compound Name | 2-[(1S,2S)-1,2,3-tris(4-methoxyphenyl)-3-oxopropyl]indene-1,3-dione |
|---|---|
| PubChem CID | 98126561 |
| Molecular Formula | C33H28O6 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 2-[(1S,2S)-1,2,3-tris(4-methoxyphenyl)-3-oxopropyl]indene-1,3-dione |
| SMILES | COc1ccc(C(=O)[C@H](c2ccc(OC)cc2)[C@H](c2ccc(OC)cc2)C2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C33H28O6/c1-37-23-14-8-20(9-15-23)28(30-32(35)26-6-4-5-7-27(26)33(30)36)29(21-10-16-24(38-2)17-11-21)31(34)22-12-18-25(39-3)19-13-22/h4-19,28-30H,1-3H3/t28-,29+/m0/s1 |
| InChIKey | ZTHOOAYERUKBKN-URLMMPGGSA-N |
| XLogP | 6.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|