C38H38O5 — CID 67265752
3-benzoyl-1-(4-tert-butylphenyl)-2-(4-methoxybenzoyl)-4-(4-propan-2-ylphenyl)butane-1,4-dione (PubChem CID 67265752) has the molecular formula C38H38O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is 3-benzoyl-1-(4-tert-butylphenyl)-2-(4-methoxybenzoyl)-4-(4-propan-2-ylphenyl)butane-1,4-dione.
| Compound Name | 3-benzoyl-1-(4-tert-butylphenyl)-2-(4-methoxybenzoyl)-4-(4-propan-2-ylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 67265752 |
| Molecular Formula | C38H38O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 3-benzoyl-1-(4-tert-butylphenyl)-2-(4-methoxybenzoyl)-4-(4-propan-2-ylphenyl)butane-1,4-dione |
| SMILES | COc1ccc(C(=O)C(C(=O)c2ccc(C(C)(C)C)cc2)C(C(=O)c2ccccc2)C(=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H38O5/c1-24(2)25-12-14-27(15-13-25)35(40)32(34(39)26-10-8-7-9-11-26)33(37(42)29-18-22-31(43-6)23-19-29)36(41)28-16-20-30(21-17-28)38(3,4)5/h7-24,32-33H,1-6H3 |
| InChIKey | ZEYHPNPRPMSWEU-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|