C26H26O4 — CID 175128821
1-(4-tert-butylphenyl)-2-(2-hydroxyphenyl)-3-(4-methoxyphenyl)propane-1,3-dione (PubChem CID 175128821) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(2-hydroxyphenyl)-3-(4-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(4-tert-butylphenyl)-2-(2-hydroxyphenyl)-3-(4-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 175128821 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(2-hydroxyphenyl)-3-(4-methoxyphenyl)propane-1,3-dione |
| SMILES | COc1ccc(C(=O)C(C(=O)c2ccc(C(C)(C)C)cc2)c2ccccc2O)cc1 |
| InChI | InChI=1S/C26H26O4/c1-26(2,3)19-13-9-17(10-14-19)24(28)23(21-7-5-6-8-22(21)27)25(29)18-11-15-20(30-4)16-12-18/h5-16,23,27H,1-4H3 |
| InChIKey | VAEVRBREJSRMMJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|