C36H38O2 — CID 102447395
1,4-bis(4-tert-butylphenyl)-2,3-diphenylbutane-1,4-dione (PubChem CID 102447395) has the molecular formula C36H38O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is 1,4-bis(4-tert-butylphenyl)-2,3-diphenylbutane-1,4-dione.
| Compound Name | 1,4-bis(4-tert-butylphenyl)-2,3-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 102447395 |
| Molecular Formula | C36H38O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 1,4-bis(4-tert-butylphenyl)-2,3-diphenylbutane-1,4-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)C(c2ccccc2)C(C(=O)c2ccc(C(C)(C)C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H38O2/c1-35(2,3)29-21-17-27(18-22-29)33(37)31(25-13-9-7-10-14-25)32(26-15-11-8-12-16-26)34(38)28-19-23-30(24-20-28)36(4,5)6/h7-24,31-32H,1-6H3 |
| InChIKey | ZUECJSLIUNTEIC-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |