C24H22O2 — CID 131847928
(2R,3R)-1-(4-methylphenyl)-2,3-diphenylpentane-1,4-dione (PubChem CID 131847928) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R,3R)-1-(4-methylphenyl)-2,3-diphenylpentane-1,4-dione.
| Compound Name | (2R,3R)-1-(4-methylphenyl)-2,3-diphenylpentane-1,4-dione |
|---|---|
| PubChem CID | 131847928 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2R,3R)-1-(4-methylphenyl)-2,3-diphenylpentane-1,4-dione |
| SMILES | CC(=O)[C@@H](c1ccccc1)[C@@H](C(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22O2/c1-17-13-15-21(16-14-17)24(26)23(20-11-7-4-8-12-20)22(18(2)25)19-9-5-3-6-10-19/h3-16,22-23H,1-2H3/t22-,23-/m0/s1 |
| InChIKey | LIDPJCOPCOZVFU-GOTSBHOMSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |