C50H40N2O4 — CID 43833720
1-N,4-N-bis(4-methylphenyl)-1-N,4-N-bis(2-oxo-1,2-diphenylethyl)benzene-1,4-dicarboxamide (PubChem CID 43833720) has the molecular formula C50H40N2O4 and a molecular weight of 732.88 g/mol. Its IUPAC name is 1-N,4-N-bis(4-methylphenyl)-1-N,4-N-bis(2-oxo-1,2-diphenylethyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-methylphenyl)-1-N,4-N-bis(2-oxo-1,2-diphenylethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 43833720 |
| Molecular Formula | C50H40N2O4 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | 1-N,4-N-bis(4-methylphenyl)-1-N,4-N-bis(2-oxo-1,2-diphenylethyl)benzene-1,4-dicarboxamide |
| SMILES | Cc1ccc(N(C(=O)c2ccc(C(=O)N(c3ccc(C)cc3)C(C(=O)c3ccccc3)c3ccccc3)cc2)C(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H40N2O4/c1-35-23-31-43(32-24-35)51(45(37-15-7-3-8-16-37)47(53)39-19-11-5-12-20-39)49(55)41-27-29-42(30-28-41)50(56)52(44-33-25-36(2)26-34-44)46(38-17-9-4-10-18-38)48(54)40-21-13-6-14-22-40/h3-34,45-46H,1-2H3 |
| InChIKey | HODGLUBDIUDPHK-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |