C52H40N2O2 — CID 101376470
1-N,4-N-bis[(1R)-1-phenylethyl]-1-N,4-N-bis[4-(2-phenylethynyl)phenyl]benzene-1,4-dicarboxamide (PubChem CID 101376470) has the molecular formula C52H40N2O2 and a molecular weight of 724.90 g/mol. Its IUPAC name is 1-N,4-N-bis[(1R)-1-phenylethyl]-1-N,4-N-bis[4-(2-phenylethynyl)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(1R)-1-phenylethyl]-1-N,4-N-bis[4-(2-phenylethynyl)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 101376470 |
| Molecular Formula | C52H40N2O2 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | 1-N,4-N-bis[(1R)-1-phenylethyl]-1-N,4-N-bis[4-(2-phenylethynyl)phenyl]benzene-1,4-dicarboxamide |
| SMILES | C[C@H](c1ccccc1)N(C(=O)c1ccc(C(=O)N(c2ccc(C#Cc3ccccc3)cc2)[C@H](C)c2ccccc2)cc1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C52H40N2O2/c1-39(45-19-11-5-12-20-45)53(49-35-27-43(28-36-49)25-23-41-15-7-3-8-16-41)51(55)47-31-33-48(34-32-47)52(56)54(40(2)46-21-13-6-14-22-46)50-37-29-44(30-38-50)26-24-42-17-9-4-10-18-42/h3-22,27-40H,1-2H3/t39-,40-/m1/s1 |
| InChIKey | FMPGYOZYPVAVEW-XRSDMRJBSA-N |
| XLogP | 11.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|