C20H21NO — CID 32690633
N-[(2R)-pentan-2-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 32690633) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[(2R)-pentan-2-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[(2R)-pentan-2-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 32690633 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[(2R)-pentan-2-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | CCC[C@@H](C)NC(=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO/c1-3-7-16(2)21-20(22)19-14-12-18(13-15-19)11-10-17-8-5-4-6-9-17/h4-6,8-9,12-16H,3,7H2,1-2H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | ACXTVTIPEZXEHG-MRXNPFEDSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|