C23H18ClNO — CID 68723730
N-(1-chloro-2-phenylethyl)-4-(2-phenylethynyl)benzamide (PubChem CID 68723730) has the molecular formula C23H18ClNO and a molecular weight of 359.86 g/mol. Its IUPAC name is N-(1-chloro-2-phenylethyl)-4-(2-phenylethynyl)benzamide.
| Compound Name | N-(1-chloro-2-phenylethyl)-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 68723730 |
| Molecular Formula | C23H18ClNO |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-(1-chloro-2-phenylethyl)-4-(2-phenylethynyl)benzamide |
| SMILES | O=C(NC(Cl)Cc1ccccc1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H18ClNO/c24-22(17-20-9-5-2-6-10-20)25-23(26)21-15-13-19(14-16-21)12-11-18-7-3-1-4-8-18/h1-10,13-16,22H,17H2,(H,25,26) |
| InChIKey | DVJFJXCFSRLXDO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|