C33H25NO3 — CID 102467085
benzyl (2S)-2-[[3,5-bis(2-phenylethynyl)benzoyl]amino]propanoate (PubChem CID 102467085) has the molecular formula C33H25NO3 and a molecular weight of 483.57 g/mol. Its IUPAC name is benzyl (2S)-2-[[3,5-bis(2-phenylethynyl)benzoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[3,5-bis(2-phenylethynyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 102467085 |
| Molecular Formula | C33H25NO3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | benzyl (2S)-2-[[3,5-bis(2-phenylethynyl)benzoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)c1cc(C#Cc2ccccc2)cc(C#Cc2ccccc2)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H25NO3/c1-25(33(36)37-24-28-15-9-4-10-16-28)34-32(35)31-22-29(19-17-26-11-5-2-6-12-26)21-30(23-31)20-18-27-13-7-3-8-14-27/h2-16,21-23,25H,24H2,1H3,(H,34,35)/t25-/m0/s1 |
| InChIKey | HXGMRWXWGXGOSM-VWLOTQADSA-N |
| XLogP | 5.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|