C21H21NO4 — CID 58342757
N-[(3S)-1,4-dihydroxy-4-methyl-2-oxopentan-3-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 58342757) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[(3S)-1,4-dihydroxy-4-methyl-2-oxopentan-3-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[(3S)-1,4-dihydroxy-4-methyl-2-oxopentan-3-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 58342757 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[(3S)-1,4-dihydroxy-4-methyl-2-oxopentan-3-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | CC(C)(O)[C@H](NC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)CO |
| InChI | InChI=1S/C21H21NO4/c1-21(2,26)19(18(24)14-23)22-20(25)17-12-10-16(11-13-17)9-8-15-6-4-3-5-7-15/h3-7,10-13,19,23,26H,14H2,1-2H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | SGLJPLCCPNJGAT-LJQANCHMSA-N |
| XLogP | 1.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|