C19H18N2O4 — CID 58343493
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(2-pyridin-3-ylethynyl)benzamide (PubChem CID 58343493) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(2-pyridin-3-ylethynyl)benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(2-pyridin-3-ylethynyl)benzamide |
|---|---|
| PubChem CID | 58343493 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(2-pyridin-3-ylethynyl)benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2cccnc2)cc1)C(=O)CO |
| InChI | InChI=1S/C19H18N2O4/c1-13(23)18(17(24)12-22)21-19(25)16-8-6-14(7-9-16)4-5-15-3-2-10-20-11-15/h2-3,6-11,13,18,22-23H,12H2,1H3,(H,21,25)/t13-,18+/m1/s1 |
| InChIKey | LWZGQELFWFTXPJ-ACJLOTCBSA-N |
| XLogP | 0.52 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|