C22H20N2O4 — CID 58342844
4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-[(4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide (PubChem CID 58342844) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-[(4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide.
| Compound Name | 4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-[(4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide |
|---|---|
| PubChem CID | 58342844 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-[4-(4-aminophenyl)buta-1,3-diynyl]-N-[(4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide |
| SMILES | C[C@@H](O)C(NC(=O)c1ccc(C#CC#Cc2ccc(N)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C22H20N2O4/c1-15(26)21(20(27)14-25)24-22(28)18-10-6-16(7-11-18)4-2-3-5-17-8-12-19(23)13-9-17/h6-13,15,21,25-26H,14,23H2,1H3,(H,24,28)/t15-,21?/m1/s1 |
| InChIKey | RCNGRJMNJGTDCB-RBFZIWAESA-N |
| XLogP | 0.71 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|