C18H19NO5 — CID 118161282
methyl 3-hydroxy-2-[[4-(6-hydroxyhexa-1,3-diynyl)benzoyl]amino]butanoate (PubChem CID 118161282) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[[4-(6-hydroxyhexa-1,3-diynyl)benzoyl]amino]butanoate.
| Compound Name | methyl 3-hydroxy-2-[[4-(6-hydroxyhexa-1,3-diynyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 118161282 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | methyl 3-hydroxy-2-[[4-(6-hydroxyhexa-1,3-diynyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(C#CC#CCCO)cc1)C(C)O |
| InChI | InChI=1S/C18H19NO5/c1-13(21)16(18(23)24-2)19-17(22)15-10-8-14(9-11-15)7-5-3-4-6-12-20/h8-11,13,16,20-21H,6,12H2,1-2H3,(H,19,22) |
| InChIKey | BBKOMYPSQSWPHF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|