C23H21NO5 — CID 158152526
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-(hydroxymethyl)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 158152526) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-(hydroxymethyl)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-(hydroxymethyl)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 158152526 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-(hydroxymethyl)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(CO)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C23H21NO5/c1-16(27)22(21(28)15-26)24-23(29)20-12-10-18(11-13-20)5-3-2-4-17-6-8-19(14-25)9-7-17/h6-13,16,22,25-27H,14-15H2,1H3,(H,24,29)/t16-,22+/m1/s1 |
| InChIKey | FVHDYTQIGNJJTE-ZHRRBRCNSA-N |
| XLogP | 0.62 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|