C30H31NO4 — CID 58342926
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-[3-(3-methylphenyl)propyl]phenyl]ethynyl]benzamide (PubChem CID 58342926) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-[3-(3-methylphenyl)propyl]phenyl]ethynyl]benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-[3-(3-methylphenyl)propyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58342926 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-[3-(3-methylphenyl)propyl]phenyl]ethynyl]benzamide |
| SMILES | Cc1cccc(CCCc2ccc(C#Cc3ccc(C(=O)N[C@H](C(=O)CO)[C@@H](C)O)cc3)cc2)c1 |
| InChI | InChI=1S/C30H31NO4/c1-21-5-3-7-26(19-21)8-4-6-23-9-11-24(12-10-23)13-14-25-15-17-27(18-16-25)30(35)31-29(22(2)33)28(34)20-32/h3,5,7,9-12,15-19,22,29,32-33H,4,6,8,20H2,1-2H3,(H,31,35)/t22-,29+/m1/s1 |
| InChIKey | PPDWCORGPQKHGJ-MNNSJKJDSA-N |
| XLogP | 3.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|