C23H29NO4 — CID 58342840
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(5-phenylpentyl)benzamide (PubChem CID 58342840) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(5-phenylpentyl)benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(5-phenylpentyl)benzamide |
|---|---|
| PubChem CID | 58342840 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(5-phenylpentyl)benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(CCCCCc2ccccc2)cc1)C(=O)CO |
| InChI | InChI=1S/C23H29NO4/c1-17(26)22(21(27)16-25)24-23(28)20-14-12-19(13-15-20)11-7-3-6-10-18-8-4-2-5-9-18/h2,4-5,8-9,12-15,17,22,25-26H,3,6-7,10-11,16H2,1H3,(H,24,28)/t17-,22+/m1/s1 |
| InChIKey | PNVGQPHFVBAGPZ-VGSWGCGISA-N |
| XLogP | 2.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|